C21H18N4O2 — CID 20685054
2-[4-[bis(2-hydroxyethyl)amino]phenyl]-2-[4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile (PubChem CID 20685054) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[4-[bis(2-hydroxyethyl)amino]phenyl]-2-[4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile.
| Compound Name | 2-[4-[bis(2-hydroxyethyl)amino]phenyl]-2-[4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 20685054 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[4-[bis(2-hydroxyethyl)amino]phenyl]-2-[4-[cyano(isocyano)methylidene]cyclohexa-2,5-dien-1-ylidene]acetonitrile |
| SMILES | [C-]#[N+]C(C#N)=c1ccc(=C(C#N)c2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-24-21(15-23)18-4-2-16(3-5-18)20(14-22)17-6-8-19(9-7-17)25(10-12-26)11-13-27/h2-9,26-27H,10-13H2/b20-16-,21-18+ |
| InChIKey | YMZKXROTYOBFCR-AOZIIYSPSA-N |
| XLogP | 0.75 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|