C23H32N2O5 — CID 21325578
[4-[bis(2-hydroxyethyl)amino]phenyl]-[4-[bis(2-hydroxypropyl)amino]phenyl]methanone (PubChem CID 21325578) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is [4-[bis(2-hydroxyethyl)amino]phenyl]-[4-[bis(2-hydroxypropyl)amino]phenyl]methanone.
| Compound Name | [4-[bis(2-hydroxyethyl)amino]phenyl]-[4-[bis(2-hydroxypropyl)amino]phenyl]methanone |
|---|---|
| PubChem CID | 21325578 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | [4-[bis(2-hydroxyethyl)amino]phenyl]-[4-[bis(2-hydroxypropyl)amino]phenyl]methanone |
| SMILES | CC(O)CN(CC(C)O)c1ccc(C(=O)c2ccc(N(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O5/c1-17(28)15-25(16-18(2)29)22-9-5-20(6-10-22)23(30)19-3-7-21(8-4-19)24(11-13-26)12-14-27/h3-10,17-18,26-29H,11-16H2,1-2H3 |
| InChIKey | VUXQKFYECAOXNE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |