C13H18NO4S- — CID 57355889
2-[4-[bis(2-hydroxyethyl)amino]phenyl]sulfanylpropanoate (PubChem CID 57355889) has the molecular formula C13H18NO4S- and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[4-[bis(2-hydroxyethyl)amino]phenyl]sulfanylpropanoate.
| Compound Name | 2-[4-[bis(2-hydroxyethyl)amino]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 57355889 |
| Molecular Formula | C13H18NO4S- |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[4-[bis(2-hydroxyethyl)amino]phenyl]sulfanylpropanoate |
| SMILES | CC(Sc1ccc(N(CCO)CCO)cc1)C(=O)[O-] |
| InChI | InChI=1S/C13H19NO4S/c1-10(13(17)18)19-12-4-2-11(3-5-12)14(6-8-15)7-9-16/h2-5,10,15-16H,6-9H2,1H3,(H,17,18)/p-1 |
| InChIKey | UBUDSMKQLLIJFL-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |