About [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+)
[4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) (PubChem CID 59102068) has the molecular formula C15H24AuNO2S2
and a molecular weight of 511.46 g/mol. Its IUPAC name is [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+).
Molecular Properties
| Compound Name | [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) |
| PubChem CID | 59102068 |
| Molecular Formula | C15H24AuNO2S2 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) |
| SMILES | CCCCSC([S-])c1ccc(N(CCO)CCO)cc1.[Au+] |
| InChI | InChI=1S/C15H25NO2S2.Au/c1-2-3-12-20-15(19)13-4-6-14(7-5-13)16(8-10-17)9-11-18;/h4-7,15,17-19H,2-3,8-12H2,1H3;/q;+1/p-1 |
| InChIKey | JKJRCNYSSRZQGC-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+)?
The IUPAC name of [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) (CID 59102068) is [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+).
What is the SMILES notation for [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+)?
The canonical SMILES for [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) is CCCCSC([S-])c1ccc(N(CCO)CCO)cc1.[Au+].
What is the InChIKey of [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+)?
The InChIKey is JKJRCNYSSRZQGC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H25NO2S2.Au/c1-2-3-12-20-15(19)13-4-6-14(7-5-13)16(8-10-17)9-11-18;/h4-7,15,17-19H,2-3,8-12H2,1H3;/q;+1/p-1.
What are the key properties of [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+)?
[4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) has a molecular weight of 511.46 g/mol, XLogP of 2.55, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[bis(2-hydroxyethyl)amino]phenyl]-butylsulfanylmethanethiolate;gold(1+) is sourced from PubChem (CID 59102068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).