C31H43N3 — CID 15131768
4-[[4-(dibutylamino)phenyl]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline (PubChem CID 15131768) has the molecular formula C31H43N3 and a molecular weight of 457.71 g/mol. Its IUPAC name is 4-[[4-(dibutylamino)phenyl]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dibutylamino)phenyl]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 15131768 |
| Molecular Formula | C31H43N3 |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 457.35 |
| IUPAC Name | 4-[[4-(dibutylamino)phenyl]-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| SMILES | CCCCN(CCCC)c1ccc(C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H43N3/c1-7-9-23-34(24-10-8-2)30-21-15-27(16-22-30)31(25-11-17-28(18-12-25)32(3)4)26-13-19-29(20-14-26)33(5)6/h11-22,31H,7-10,23-24H2,1-6H3 |
| InChIKey | ICFRCLUUPRDGAA-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|