C32H41N3 — CID 18998057
N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-(1H-indol-2-yl)methyl]-3-methylaniline (PubChem CID 18998057) has the molecular formula C32H41N3 and a molecular weight of 467.70 g/mol. Its IUPAC name is N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-(1H-indol-2-yl)methyl]-3-methylaniline.
| Compound Name | N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-(1H-indol-2-yl)methyl]-3-methylaniline |
|---|---|
| PubChem CID | 18998057 |
| Molecular Formula | C32H41N3 |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-(1H-indol-2-yl)methyl]-3-methylaniline |
| SMILES | CCCCN(CCCC)c1ccc(C(c2ccc(N(C)C)cc2)c2cc3ccccc3[nH]2)c(C)c1 |
| InChI | InChI=1S/C32H41N3/c1-6-8-20-35(21-9-7-2)28-18-19-29(24(3)22-28)32(25-14-16-27(17-15-25)34(4)5)31-23-26-12-10-11-13-30(26)33-31/h10-19,22-23,32-33H,6-9,20-21H2,1-5H3 |
| InChIKey | VPNVXZRLDXFDBL-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|