C52H53N3 — CID 91746104
4-[bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl]-N,N-diethyl-3-methylaniline (PubChem CID 91746104) has the molecular formula C52H53N3 and a molecular weight of 720.02 g/mol. Its IUPAC name is 4-[bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 91746104 |
| Molecular Formula | C52H53N3 |
| Molecular Weight | 720.02 g/mol |
| Exact Mass | 719.42 |
| IUPAC Name | 4-[bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C52H53N3/c1-8-53(9-2)50-34-35-51(41(7)36-50)52(42-18-30-48(31-19-42)54(44-22-10-37(3)11-23-44)45-24-12-38(4)13-25-45)43-20-32-49(33-21-43)55(46-26-14-39(5)15-27-46)47-28-16-40(6)17-29-47/h10-36,52H,8-9H2,1-7H3 |
| InChIKey | ONYDVPCBWQDIDF-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.02 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|