C36H51N5O2 — CID 20537677
N-[2-[[2-acetamido-4-(diethylamino)phenyl]-[4-(diethylamino)-2-methylphenyl]methyl]-5-(diethylamino)phenyl]acetamide (PubChem CID 20537677) has the molecular formula C36H51N5O2 and a molecular weight of 585.84 g/mol. Its IUPAC name is N-[2-[[2-acetamido-4-(diethylamino)phenyl]-[4-(diethylamino)-2-methylphenyl]methyl]-5-(diethylamino)phenyl]acetamide.
| Compound Name | N-[2-[[2-acetamido-4-(diethylamino)phenyl]-[4-(diethylamino)-2-methylphenyl]methyl]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 20537677 |
| Molecular Formula | C36H51N5O2 |
| Molecular Weight | 585.84 g/mol |
| Exact Mass | 585.40 |
| IUPAC Name | N-[2-[[2-acetamido-4-(diethylamino)phenyl]-[4-(diethylamino)-2-methylphenyl]methyl]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2NC(C)=O)c2ccc(N(CC)CC)cc2NC(C)=O)c(C)c1 |
| InChI | InChI=1S/C36H51N5O2/c1-10-39(11-2)28-16-19-31(25(7)22-28)36(32-20-17-29(40(12-3)13-4)23-34(32)37-26(8)42)33-21-18-30(41(14-5)15-6)24-35(33)38-27(9)43/h16-24,36H,10-15H2,1-9H3,(H,37,42)(H,38,43) |
| InChIKey | VWJRZXVUPAOGMK-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.84 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|