C35H42N2 — CID 70996934
4-[[4-(diethylamino)-2-methylphenyl]-(4-phenylphenyl)methyl]-N,N-diethyl-3-methylaniline (PubChem CID 70996934) has the molecular formula C35H42N2 and a molecular weight of 490.74 g/mol. Its IUPAC name is 4-[[4-(diethylamino)-2-methylphenyl]-(4-phenylphenyl)methyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[[4-(diethylamino)-2-methylphenyl]-(4-phenylphenyl)methyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 70996934 |
| Molecular Formula | C35H42N2 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 4-[[4-(diethylamino)-2-methylphenyl]-(4-phenylphenyl)methyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(-c3ccccc3)cc2)c2ccc(N(CC)CC)cc2C)c(C)c1 |
| InChI | InChI=1S/C35H42N2/c1-7-36(8-2)31-20-22-33(26(5)24-31)35(34-23-21-32(25-27(34)6)37(9-3)10-4)30-18-16-29(17-19-30)28-14-12-11-13-15-28/h11-25,35H,7-10H2,1-6H3 |
| InChIKey | HXPHUZPRXWHAOX-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|