C43H53N3O3S — CID 144754054
6-[2-(diethylamino)-5-[[4-(diethylamino)-2-methylphenyl]-[4-(diethylamino)phenyl]methyl]-4-methylphenyl]naphthalene-1-sulfonic acid (PubChem CID 144754054) has the molecular formula C43H53N3O3S and a molecular weight of 691.98 g/mol. Its IUPAC name is 6-[2-(diethylamino)-5-[[4-(diethylamino)-2-methylphenyl]-[4-(diethylamino)phenyl]methyl]-4-methylphenyl]naphthalene-1-sulfonic acid.
| Compound Name | 6-[2-(diethylamino)-5-[[4-(diethylamino)-2-methylphenyl]-[4-(diethylamino)phenyl]methyl]-4-methylphenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 144754054 |
| Molecular Formula | C43H53N3O3S |
| Molecular Weight | 691.98 g/mol |
| Exact Mass | 691.38 |
| IUPAC Name | 6-[2-(diethylamino)-5-[[4-(diethylamino)-2-methylphenyl]-[4-(diethylamino)phenyl]methyl]-4-methylphenyl]naphthalene-1-sulfonic acid |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2C)c2cc(-c3ccc4c(S(=O)(=O)O)cccc4c3)c(N(CC)CC)cc2C)cc1 |
| InChI | InChI=1S/C43H53N3O3S/c1-9-44(10-2)35-21-18-32(19-22-35)43(37-25-23-36(26-30(37)7)45(11-3)12-4)39-29-40(41(27-31(39)8)46(13-5)14-6)34-20-24-38-33(28-34)16-15-17-42(38)50(47,48)49/h15-29,43H,9-14H2,1-8H3,(H,47,48,49) |
| InChIKey | ANOQOVMMMARBRC-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.98 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|