C52H54N2O3S — CID 90760054
4-[[4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline;naphthalene-1-sulfonic acid (PubChem CID 90760054) has the molecular formula C52H54N2O3S and a molecular weight of 787.08 g/mol. Its IUPAC name is 4-[[4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline;naphthalene-1-sulfonic acid.
| Compound Name | 4-[[4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline;naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 90760054 |
| Molecular Formula | C52H54N2O3S |
| Molecular Weight | 787.08 g/mol |
| Exact Mass | 786.39 |
| IUPAC Name | 4-[[4-[bis(4-methylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline;naphthalene-1-sulfonic acid |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)=c2ccc(=C(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C42H46N2.C10H8O3S/c1-7-43(8-2)39-27-23-37(24-28-39)42(38-25-29-40(30-26-38)44(9-3)10-4)36-21-19-35(20-22-36)41(33-15-11-31(5)12-16-33)34-17-13-32(6)14-18-34;11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h11-30H,7-10H2,1-6H3;1-7H,(H,11,12,13) |
| InChIKey | VRPATADAMONTKI-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.08 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|