C43H50N2O3S — CID 155096446
2-[bis[4-(N-butyl-4-methylanilino)-3-methylphenyl]methyl]benzenesulfonic acid (PubChem CID 155096446) has the molecular formula C43H50N2O3S and a molecular weight of 674.95 g/mol. Its IUPAC name is 2-[bis[4-(N-butyl-4-methylanilino)-3-methylphenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[bis[4-(N-butyl-4-methylanilino)-3-methylphenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 155096446 |
| Molecular Formula | C43H50N2O3S |
| Molecular Weight | 674.95 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | 2-[bis[4-(N-butyl-4-methylanilino)-3-methylphenyl]methyl]benzenesulfonic acid |
| SMILES | CCCCN(c1ccc(C)cc1)c1ccc(C(c2ccc(N(CCCC)c3ccc(C)cc3)c(C)c2)c2ccccc2S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C43H50N2O3S/c1-7-9-27-44(37-21-15-31(3)16-22-37)40-25-19-35(29-33(40)5)43(39-13-11-12-14-42(39)49(46,47)48)36-20-26-41(34(6)30-36)45(28-10-8-2)38-23-17-32(4)18-24-38/h11-26,29-30,43H,7-10,27-28H2,1-6H3,(H,46,47,48) |
| InChIKey | AHIXYDHDMHRUEK-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.95 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|