C41H46N2O3S — CID 155096409
2-[bis[4-(N-butylanilino)-3-methylphenyl]methyl]benzenesulfonic acid (PubChem CID 155096409) has the molecular formula C41H46N2O3S and a molecular weight of 646.90 g/mol. Its IUPAC name is 2-[bis[4-(N-butylanilino)-3-methylphenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[bis[4-(N-butylanilino)-3-methylphenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 155096409 |
| Molecular Formula | C41H46N2O3S |
| Molecular Weight | 646.90 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | 2-[bis[4-(N-butylanilino)-3-methylphenyl]methyl]benzenesulfonic acid |
| SMILES | CCCCN(c1ccccc1)c1ccc(C(c2ccc(N(CCCC)c3ccccc3)c(C)c2)c2ccccc2S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C41H46N2O3S/c1-5-7-27-42(35-17-11-9-12-18-35)38-25-23-33(29-31(38)3)41(37-21-15-16-22-40(37)47(44,45)46)34-24-26-39(32(4)30-34)43(28-8-6-2)36-19-13-10-14-20-36/h9-26,29-30,41H,5-8,27-28H2,1-4H3,(H,44,45,46) |
| InChIKey | OAUKZXRATANGPR-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.90 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|