C39H42N2O9S3 — CID 129024906
2,4,6-trimethyl-3-[N-methyl-4-[(2-sulfophenyl)-[4-(N,2,4,6-tetramethyl-3-sulfoanilino)phenyl]methyl]anilino]benzenesulfonic acid (PubChem CID 129024906) has the molecular formula C39H42N2O9S3 and a molecular weight of 778.97 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-[N-methyl-4-[(2-sulfophenyl)-[4-(N,2,4,6-tetramethyl-3-sulfoanilino)phenyl]methyl]anilino]benzenesulfonic acid.
| Compound Name | 2,4,6-trimethyl-3-[N-methyl-4-[(2-sulfophenyl)-[4-(N,2,4,6-tetramethyl-3-sulfoanilino)phenyl]methyl]anilino]benzenesulfonic acid |
|---|---|
| PubChem CID | 129024906 |
| Molecular Formula | C39H42N2O9S3 |
| Molecular Weight | 778.97 g/mol |
| Exact Mass | 778.21 |
| IUPAC Name | 2,4,6-trimethyl-3-[N-methyl-4-[(2-sulfophenyl)-[4-(N,2,4,6-tetramethyl-3-sulfoanilino)phenyl]methyl]anilino]benzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(C)c1N(C)c1ccc(C(c2ccc(N(C)c3c(C)cc(C)c(S(=O)(=O)O)c3C)cc2)c2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C39H42N2O9S3/c1-23-21-25(3)38(52(45,46)47)27(5)36(23)40(7)31-17-13-29(14-18-31)35(33-11-9-10-12-34(33)51(42,43)44)30-15-19-32(20-16-30)41(8)37-24(2)22-26(4)39(28(37)6)53(48,49)50/h9-22,35H,1-8H3,(H,42,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | FJXNYDWHOPJRQB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.97 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|