C27H34N2O4S — CID 168759811
2-[bis[4-(diethylamino)phenyl]methyl]-4-hydroxybenzenesulfonic acid (PubChem CID 168759811) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is 2-[bis[4-(diethylamino)phenyl]methyl]-4-hydroxybenzenesulfonic acid.
| Compound Name | 2-[bis[4-(diethylamino)phenyl]methyl]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 168759811 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-[bis[4-(diethylamino)phenyl]methyl]-4-hydroxybenzenesulfonic acid |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)c2cc(O)ccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O4S/c1-5-28(6-2)22-13-9-20(10-14-22)27(21-11-15-23(16-12-21)29(7-3)8-4)25-19-24(30)17-18-26(25)34(31,32)33/h9-19,27,30H,5-8H2,1-4H3,(H,31,32,33) |
| InChIKey | QCTRRKRWUOEXEM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|