C23H26N2O6S2 — CID 21116424
4-[bis[4-(dimethylamino)phenyl]methyl]benzene-1,3-disulfonic acid (PubChem CID 21116424) has the molecular formula C23H26N2O6S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-[bis[4-(dimethylamino)phenyl]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[bis[4-(dimethylamino)phenyl]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 21116424 |
| Molecular Formula | C23H26N2O6S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 4-[bis[4-(dimethylamino)phenyl]methyl]benzene-1,3-disulfonic acid |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H26N2O6S2/c1-24(2)18-9-5-16(6-10-18)23(17-7-11-19(12-8-17)25(3)4)21-14-13-20(32(26,27)28)15-22(21)33(29,30)31/h5-15,23H,1-4H3,(H,26,27,28)(H,29,30,31) |
| InChIKey | HYFYBTZCIIRIAF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|