C13H20O5S2 — CID 167263436
5-tert-butylsulfonyl-2-propan-2-ylbenzenesulfonic acid (PubChem CID 167263436) has the molecular formula C13H20O5S2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 5-tert-butylsulfonyl-2-propan-2-ylbenzenesulfonic acid.
| Compound Name | 5-tert-butylsulfonyl-2-propan-2-ylbenzenesulfonic acid |
|---|---|
| PubChem CID | 167263436 |
| Molecular Formula | C13H20O5S2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-tert-butylsulfonyl-2-propan-2-ylbenzenesulfonic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)C(C)(C)C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C13H20O5S2/c1-9(2)11-7-6-10(8-12(11)20(16,17)18)19(14,15)13(3,4)5/h6-9H,1-5H3,(H,16,17,18) |
| InChIKey | UZDIWJLUSDCLSH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|