C11H15BrO6S2 — CID 87765653
4-(1-bromo-2,2-dimethylpropyl)benzene-1,3-disulfonic acid (PubChem CID 87765653) has the molecular formula C11H15BrO6S2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 4-(1-bromo-2,2-dimethylpropyl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(1-bromo-2,2-dimethylpropyl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 87765653 |
| Molecular Formula | C11H15BrO6S2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 4-(1-bromo-2,2-dimethylpropyl)benzene-1,3-disulfonic acid |
| SMILES | CC(C)(C)C(Br)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C11H15BrO6S2/c1-11(2,3)10(12)8-5-4-7(19(13,14)15)6-9(8)20(16,17)18/h4-6,10H,1-3H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | SNKVEFRJOLESDT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|