4-iodylbenzene-1,3-disulfonic acid

C6H5IO8S2 — CID 23357753

IUPAC4-iodylbenzene-1,3-disulfonic acid
SMILESO=I(=O)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O
InChIInChI=1S/C6H5IO8S2/c8-7(9)5-2-1-4(16(10,11)12)3-6(5)17(13,14)15/h1-3H,(H,10,11,12)(H,13,14,15)
InChIKeyKFRIDEASDQWLCI-UHFFFAOYSA-N
MW396.14 g/mol
LogP0.55
Rot. Bonds3

About 4-iodylbenzene-1,3-disulfonic acid

4-iodylbenzene-1,3-disulfonic acid (PubChem CID 23357753) has the molecular formula C6H5IO8S2 and a molecular weight of 396.14 g/mol. Its IUPAC name is 4-iodylbenzene-1,3-disulfonic acid.

Molecular Properties

Compound Name4-iodylbenzene-1,3-disulfonic acid
PubChem CID23357753
Molecular FormulaC6H5IO8S2
Molecular Weight396.14 g/mol
Exact Mass395.85
IUPAC Name4-iodylbenzene-1,3-disulfonic acid
SMILESO=I(=O)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O
InChIInChI=1S/C6H5IO8S2/c8-7(9)5-2-1-4(16(10,11)12)3-6(5)17(13,14)15/h1-3H,(H,10,11,12)(H,13,14,15)
InChIKeyKFRIDEASDQWLCI-UHFFFAOYSA-N
XLogP0.55
TPSA142.88 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500396.14
LogP ≤ 50.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-iodylbenzene-1,3-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-iodylbenzene-1,3-disulfonic acid?
The IUPAC name of 4-iodylbenzene-1,3-disulfonic acid (CID 23357753) is 4-iodylbenzene-1,3-disulfonic acid.
What is the SMILES notation for 4-iodylbenzene-1,3-disulfonic acid?
The canonical SMILES for 4-iodylbenzene-1,3-disulfonic acid is O=I(=O)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O.
What is the InChIKey of 4-iodylbenzene-1,3-disulfonic acid?
The InChIKey is KFRIDEASDQWLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5IO8S2/c8-7(9)5-2-1-4(16(10,11)12)3-6(5)17(13,14)15/h1-3H,(H,10,11,12)(H,13,14,15).
What are the key properties of 4-iodylbenzene-1,3-disulfonic acid?
4-iodylbenzene-1,3-disulfonic acid has a molecular weight of 396.14 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodylbenzene-1,3-disulfonic acid is sourced from PubChem (CID 23357753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).