C6H5IO8S2 — CID 23357753
4-iodylbenzene-1,3-disulfonic acid (PubChem CID 23357753) has the molecular formula C6H5IO8S2 and a molecular weight of 396.14 g/mol. Its IUPAC name is 4-iodylbenzene-1,3-disulfonic acid.
| Compound Name | 4-iodylbenzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 23357753 |
| Molecular Formula | C6H5IO8S2 |
| Molecular Weight | 396.14 g/mol |
| Exact Mass | 395.85 |
| IUPAC Name | 4-iodylbenzene-1,3-disulfonic acid |
| SMILES | O=I(=O)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C6H5IO8S2/c8-7(9)5-2-1-4(16(10,11)12)3-6(5)17(13,14)15/h1-3H,(H,10,11,12)(H,13,14,15) |
| InChIKey | KFRIDEASDQWLCI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|