C7H8N2O6S2 — CID 88636165
4-methanehydrazonoylbenzene-1,3-disulfonic acid (PubChem CID 88636165) has the molecular formula C7H8N2O6S2 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-methanehydrazonoylbenzene-1,3-disulfonic acid.
| Compound Name | 4-methanehydrazonoylbenzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 88636165 |
| Molecular Formula | C7H8N2O6S2 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 4-methanehydrazonoylbenzene-1,3-disulfonic acid |
| SMILES | NN=Cc1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H8N2O6S2/c8-9-4-5-1-2-6(16(10,11)12)3-7(5)17(13,14)15/h1-4H,8H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | PFLSIBSLDYAGLK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|