C7H9N3O3S — CID 168530964
2-amino-4-methanehydrazonoylbenzenesulfonic acid (PubChem CID 168530964) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-amino-4-methanehydrazonoylbenzenesulfonic acid.
| Compound Name | 2-amino-4-methanehydrazonoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 168530964 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-amino-4-methanehydrazonoylbenzenesulfonic acid |
| SMILES | NN=Cc1ccc(S(=O)(=O)O)c(N)c1 |
| InChI | InChI=1S/C7H9N3O3S/c8-6-3-5(4-10-9)1-2-7(6)14(11,12)13/h1-4H,8-9H2,(H,11,12,13) |
| InChIKey | GRGMRXWQDONIRF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|