C16H16N2O8S2 — CID 135800105
3-hydroxy-4-[2-[(2-hydroxy-4-sulfophenyl)methylideneamino]ethyliminomethyl]benzenesulfonic acid (PubChem CID 135800105) has the molecular formula C16H16N2O8S2 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-hydroxy-4-[2-[(2-hydroxy-4-sulfophenyl)methylideneamino]ethyliminomethyl]benzenesulfonic acid.
| Compound Name | 3-hydroxy-4-[2-[(2-hydroxy-4-sulfophenyl)methylideneamino]ethyliminomethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135800105 |
| Molecular Formula | C16H16N2O8S2 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 3-hydroxy-4-[2-[(2-hydroxy-4-sulfophenyl)methylideneamino]ethyliminomethyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/C=N/CC/N=C/c2ccc(S(=O)(=O)O)cc2O)c(O)c1 |
| InChI | InChI=1S/C16H16N2O8S2/c19-15-7-13(27(21,22)23)3-1-11(15)9-17-5-6-18-10-12-2-4-14(8-16(12)20)28(24,25)26/h1-4,7-10,19-20H,5-6H2,(H,21,22,23)(H,24,25,26)/b17-9+,18-10+ |
| InChIKey | QINNVARXFSHQFC-BEQMOXJMSA-N |
| XLogP | 1.13 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|