C14H13NO4S — CID 139241232
3-(benzyliminomethyl)-4-hydroxybenzenesulfonic acid (PubChem CID 139241232) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-(benzyliminomethyl)-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-(benzyliminomethyl)-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 139241232 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-(benzyliminomethyl)-4-hydroxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(/C=N/Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H13NO4S/c16-14-7-6-13(20(17,18)19)8-12(14)10-15-9-11-4-2-1-3-5-11/h1-8,10,16H,9H2,(H,17,18,19)/b15-10+ |
| InChIKey | LNCZAFAVGMEYJA-XNTDXEJSSA-N |
| XLogP | 2.26 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|