C15H15NO — CID 135657309
2-[(4-methylphenyl)methyliminomethyl]phenol (PubChem CID 135657309) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyliminomethyl]phenol.
| Compound Name | 2-[(4-methylphenyl)methyliminomethyl]phenol |
|---|---|
| PubChem CID | 135657309 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[(4-methylphenyl)methyliminomethyl]phenol |
| SMILES | Cc1ccc(C/N=C/c2ccccc2O)cc1 |
| InChI | InChI=1S/C15H15NO/c1-12-6-8-13(9-7-12)10-16-11-14-4-2-3-5-15(14)17/h2-9,11,17H,10H2,1H3/b16-11+ |
| InChIKey | DSZFNPOGONTMCN-LFIBNONCSA-N |
| XLogP | 3.32 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|