C7H6NaO5S — CID 87885081
CID 87885081 (PubChem CID 87885081) has the molecular formula C7H6NaO5S and a molecular weight of 225.18 g/mol.
| Compound Name | CID 87885081 |
|---|---|
| PubChem CID | 87885081 |
| Molecular Formula | C7H6NaO5S |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | — |
| SMILES | O=Cc1cc(S(=O)(=O)O)ccc1O.[Na] |
| InChI | InChI=1S/C7H6O5S.Na/c8-4-5-3-6(13(10,11)12)1-2-7(5)9;/h1-4,9H,(H,10,11,12); |
| InChIKey | VXDIDCJRMNKJOT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|