C12H12N2O4S — CID 141380053
3-[(2-amino-2H-pyridin-3-ylidene)methyl]-4-hydroxybenzenesulfonic acid (PubChem CID 141380053) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-[(2-amino-2H-pyridin-3-ylidene)methyl]-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-[(2-amino-2H-pyridin-3-ylidene)methyl]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 141380053 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-[(2-amino-2H-pyridin-3-ylidene)methyl]-4-hydroxybenzenesulfonic acid |
| SMILES | NC1N=CC=CC1=Cc1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C12H12N2O4S/c13-12-8(2-1-5-14-12)6-9-7-10(19(16,17)18)3-4-11(9)15/h1-7,12,15H,13H2,(H,16,17,18) |
| InChIKey | FMPPQVDARNFFJI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|