C30H20O8 — CID 146013313
2-hydroxy-5-[1,2,2-tris(3-formyl-4-hydroxyphenyl)ethenyl]benzaldehyde (PubChem CID 146013313) has the molecular formula C30H20O8 and a molecular weight of 508.48 g/mol. Its IUPAC name is 2-hydroxy-5-[1,2,2-tris(3-formyl-4-hydroxyphenyl)ethenyl]benzaldehyde.
| Compound Name | 2-hydroxy-5-[1,2,2-tris(3-formyl-4-hydroxyphenyl)ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 146013313 |
| Molecular Formula | C30H20O8 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-hydroxy-5-[1,2,2-tris(3-formyl-4-hydroxyphenyl)ethenyl]benzaldehyde |
| SMILES | O=Cc1cc(C(=C(c2ccc(O)c(C=O)c2)c2ccc(O)c(C=O)c2)c2ccc(O)c(C=O)c2)ccc1O |
| InChI | InChI=1S/C30H20O8/c31-13-21-9-17(1-5-25(21)35)29(18-2-6-26(36)22(10-18)14-32)30(19-3-7-27(37)23(11-19)15-33)20-4-8-28(38)24(12-20)16-34/h1-16,35-38H |
| InChIKey | GUHLLWSXHXBUGB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|