C18H18N2Na2O10S2 — CID 101498633
disodium;2-methoxy-6-[2-[(3-methoxy-2-oxido-5-sulfophenyl)methylideneamino]ethyliminomethyl]-4-sulfophenolate (PubChem CID 101498633) has the molecular formula C18H18N2Na2O10S2 and a molecular weight of 532.46 g/mol. Its IUPAC name is disodium;2-methoxy-6-[2-[(3-methoxy-2-oxido-5-sulfophenyl)methylideneamino]ethyliminomethyl]-4-sulfophenolate.
| Compound Name | disodium;2-methoxy-6-[2-[(3-methoxy-2-oxido-5-sulfophenyl)methylideneamino]ethyliminomethyl]-4-sulfophenolate |
|---|---|
| PubChem CID | 101498633 |
| Molecular Formula | C18H18N2Na2O10S2 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | disodium;2-methoxy-6-[2-[(3-methoxy-2-oxido-5-sulfophenyl)methylideneamino]ethyliminomethyl]-4-sulfophenolate |
| SMILES | COc1cc(S(=O)(=O)O)cc(/C=N/CC/N=C/c2cc(S(=O)(=O)O)cc(OC)c2[O-])c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C18H20N2O10S2.2Na/c1-29-15-7-13(31(23,24)25)5-11(17(15)21)9-19-3-4-20-10-12-6-14(32(26,27)28)8-16(30-2)18(12)22;;/h5-10,21-22H,3-4H2,1-2H3,(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2/b19-9+,20-10+;; |
| InChIKey | OZYDJIPGVHUJPB-OCMVVAPRSA-L |
| XLogP | -6.11 |
| TPSA | 198.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|