C20H24N2O6Zn — CID 139072510
zinc bis(2-(2-hydroxyethyliminomethyl)-6-methoxyphenolate) (PubChem CID 139072510) has the molecular formula C20H24N2O6Zn and a molecular weight of 453.81 g/mol. Its IUPAC name is zinc bis(2-(2-hydroxyethyliminomethyl)-6-methoxyphenolate).
| Compound Name | zinc bis(2-(2-hydroxyethyliminomethyl)-6-methoxyphenolate) |
|---|---|
| PubChem CID | 139072510 |
| Molecular Formula | C20H24N2O6Zn |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | zinc bis(2-(2-hydroxyethyliminomethyl)-6-methoxyphenolate) |
| SMILES | COc1cccc(/C=N/CCO)c1[O-].COc1cccc(/C=N/CCO)c1[O-].[Zn+2] |
| InChI | InChI=1S/2C10H13NO3.Zn/c2*1-14-9-4-2-3-8(10(9)13)7-11-5-6-12;/h2*2-4,7,12-13H,5-6H2,1H3;/q;;+2/p-2/b2*11-7+; |
| InChIKey | QETDFBZHWIGETO-NVFNPILPSA-L |
| XLogP | 0.36 |
| TPSA | 129.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|