C9H11NO3 — CID 135744038
3-(2-hydroxyethyliminomethyl)benzene-1,2-diol (PubChem CID 135744038) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-(2-hydroxyethyliminomethyl)benzene-1,2-diol.
| Compound Name | 3-(2-hydroxyethyliminomethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 135744038 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-(2-hydroxyethyliminomethyl)benzene-1,2-diol |
| SMILES | OCC/N=C/c1cccc(O)c1O |
| InChI | InChI=1S/C9H11NO3/c11-5-4-10-6-7-2-1-3-8(12)9(7)13/h1-3,6,11-13H,4-5H2/b10-6+ |
| InChIKey | SENZBOCZWHBPJF-UXBLZVDNSA-N |
| XLogP | 0.51 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|