C18H30N4O — CID 136704302
2,6-bis[3-(dimethylamino)propyliminomethyl]phenol (PubChem CID 136704302) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,6-bis[3-(dimethylamino)propyliminomethyl]phenol.
| Compound Name | 2,6-bis[3-(dimethylamino)propyliminomethyl]phenol |
|---|---|
| PubChem CID | 136704302 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 2,6-bis[3-(dimethylamino)propyliminomethyl]phenol |
| SMILES | CN(C)CCC/N=C/c1cccc(/C=N/CCCN(C)C)c1O |
| InChI | InChI=1S/C18H30N4O/c1-21(2)12-6-10-19-14-16-8-5-9-17(18(16)23)15-20-11-7-13-22(3)4/h5,8-9,14-15,23H,6-7,10-13H2,1-4H3/b19-14+,20-15+ |
| InChIKey | KHWJTLDBSMCYBS-PXXPDPNMSA-N |
| XLogP | 2.13 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|