C12H15F3N2 — CID 102365313
N,N-dimethyl-3-[(2,3,4-trifluorophenyl)methylideneamino]propan-1-amine (PubChem CID 102365313) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2,3,4-trifluorophenyl)methylideneamino]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[(2,3,4-trifluorophenyl)methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 102365313 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N,N-dimethyl-3-[(2,3,4-trifluorophenyl)methylideneamino]propan-1-amine |
| SMILES | CN(C)CCC/N=C/c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H15F3N2/c1-17(2)7-3-6-16-8-9-4-5-10(13)12(15)11(9)14/h4-5,8H,3,6-7H2,1-2H3/b16-8+ |
| InChIKey | YLUZAODKMXQFKU-LZYBPNLTSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|