C11H15FN2 — CID 102365312
2-[(4-fluorophenyl)methylideneamino]-N,N-dimethylethanamine (PubChem CID 102365312) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylideneamino]-N,N-dimethylethanamine.
| Compound Name | 2-[(4-fluorophenyl)methylideneamino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 102365312 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methylideneamino]-N,N-dimethylethanamine |
| SMILES | CN(C)CC/N=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2/c1-14(2)8-7-13-9-10-3-5-11(12)6-4-10/h3-6,9H,7-8H2,1-2H3/b13-9+ |
| InChIKey | XLNXJKLGHOWCLU-UKTHLTGXSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|