C17H30N2 — CID 143665839
2-[(4-tert-butylphenyl)methylideneamino]-N,N-dimethylethanamine;ethane (PubChem CID 143665839) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methylideneamino]-N,N-dimethylethanamine;ethane.
| Compound Name | 2-[(4-tert-butylphenyl)methylideneamino]-N,N-dimethylethanamine;ethane |
|---|---|
| PubChem CID | 143665839 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methylideneamino]-N,N-dimethylethanamine;ethane |
| SMILES | CC.CN(C)CC/N=C/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24N2.C2H6/c1-15(2,3)14-8-6-13(7-9-14)12-16-10-11-17(4)5;1-2/h6-9,12H,10-11H2,1-5H3;1-2H3/b16-12+; |
| InChIKey | KEAYODSIKMYKTC-CLNHMMGSSA-N |
| XLogP | 3.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|