C15H17BrN2 — CID 132933361
2-[(8-bromonaphthalen-1-yl)methylideneamino]-N,N-dimethylethanamine (PubChem CID 132933361) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[(8-bromonaphthalen-1-yl)methylideneamino]-N,N-dimethylethanamine.
| Compound Name | 2-[(8-bromonaphthalen-1-yl)methylideneamino]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 132933361 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[(8-bromonaphthalen-1-yl)methylideneamino]-N,N-dimethylethanamine |
| SMILES | CN(C)CC/N=C/c1cccc2cccc(Br)c12 |
| InChI | InChI=1S/C15H17BrN2/c1-18(2)10-9-17-11-13-7-3-5-12-6-4-8-14(16)15(12)13/h3-8,11H,9-10H2,1-2H3/b17-11+ |
| InChIKey | UBDWBPGFBCNESN-GZTJUZNOSA-N |
| XLogP | 3.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|