C23H33N3 — CID 102262356
N-[2-[2-(dimethylamino)ethyliminomethyl]phenyl]-2,6-di(propan-2-yl)aniline (PubChem CID 102262356) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyliminomethyl]phenyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[2-[2-(dimethylamino)ethyliminomethyl]phenyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 102262356 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyliminomethyl]phenyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1ccccc1/C=N\CCN(C)C |
| InChI | InChI=1S/C23H33N3/c1-17(2)20-11-9-12-21(18(3)4)23(20)25-22-13-8-7-10-19(22)16-24-14-15-26(5)6/h7-13,16-18,25H,14-15H2,1-6H3/b24-16- |
| InChIKey | UREVHVCYMFLAOF-JLPGSUDCSA-N |
| XLogP | 5.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|