C12H15N5S2Zn — CID 139068771
zinc;N,N-dimethyl-2-(pyridin-2-ylmethylideneamino)ethanamine;diisothiocyanate (PubChem CID 139068771) has the molecular formula C12H15N5S2Zn and a molecular weight of 358.81 g/mol. Its IUPAC name is zinc;N,N-dimethyl-2-(pyridin-2-ylmethylideneamino)ethanamine;diisothiocyanate.
| Compound Name | zinc;N,N-dimethyl-2-(pyridin-2-ylmethylideneamino)ethanamine;diisothiocyanate |
|---|---|
| PubChem CID | 139068771 |
| Molecular Formula | C12H15N5S2Zn |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | zinc;N,N-dimethyl-2-(pyridin-2-ylmethylideneamino)ethanamine;diisothiocyanate |
| SMILES | CN(C)CC/N=C/c1ccccn1.[N-]=C=S.[N-]=C=S.[Zn+2] |
| InChI | InChI=1S/C10H15N3.2CNS.Zn/c1-13(2)8-7-11-9-10-5-3-4-6-12-10;2*2-1-3;/h3-6,9H,7-8H2,1-2H3;;;/q;2*-1;+2/b11-9+;;; |
| InChIKey | QUZKGHVGTQSULU-OOQPXJNPSA-N |
| XLogP | 2.38 |
| TPSA | 73.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|