C18H24N6 — CID 135011278
N',N'-bis[2-(pyridin-2-ylmethylideneamino)ethyl]ethane-1,2-diamine (PubChem CID 135011278) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is N',N'-bis[2-(pyridin-2-ylmethylideneamino)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-bis[2-(pyridin-2-ylmethylideneamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 135011278 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | N',N'-bis[2-(pyridin-2-ylmethylideneamino)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CC/N=C/c1ccccn1)CC/N=C/c1ccccn1 |
| InChI | InChI=1S/C18H24N6/c19-7-12-24(13-10-20-15-17-5-1-3-8-22-17)14-11-21-16-18-6-2-4-9-23-18/h1-6,8-9,15-16H,7,10-14,19H2/b20-15+,21-16+ |
| InChIKey | AHIHAULSRWCQAT-YJKAXRSRSA-N |
| XLogP | 1.28 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|