C32H34N4 — CID 102518992
N-[2-[2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]ethyliminomethyl]phenyl]-2,6-dimethylaniline (PubChem CID 102518992) has the molecular formula C32H34N4 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[2-[2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]ethyliminomethyl]phenyl]-2,6-dimethylaniline.
| Compound Name | N-[2-[2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]ethyliminomethyl]phenyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 102518992 |
| Molecular Formula | C32H34N4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | N-[2-[2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]ethyliminomethyl]phenyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1Nc1ccccc1/C=N\CC/N=C/c1ccccc1Nc1c(C)cccc1C |
| InChI | InChI=1S/C32H34N4/c1-23-11-9-12-24(2)31(23)35-29-17-7-5-15-27(29)21-33-19-20-34-22-28-16-6-8-18-30(28)36-32-25(3)13-10-14-26(32)4/h5-18,21-22,35-36H,19-20H2,1-4H3/b33-21-,34-22+ |
| InChIKey | HJWOFJJFDPOTEF-NRYMNODQSA-N |
| XLogP | 7.95 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|