C24H25N3 — CID 102486072
N'-(2,6-dimethylphenyl)-N-[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]methanimidamide (PubChem CID 102486072) has the molecular formula C24H25N3 and a molecular weight of 355.49 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]methanimidamide.
| Compound Name | N'-(2,6-dimethylphenyl)-N-[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 102486072 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]methanimidamide |
| SMILES | Cc1cccc(C)c1/N=C/Nc1ccccc1/C=N/c1c(C)cccc1C |
| InChI | InChI=1S/C24H25N3/c1-17-9-7-10-18(2)23(17)25-15-21-13-5-6-14-22(21)26-16-27-24-19(3)11-8-12-20(24)4/h5-16H,1-4H3,(H,26,27)/b25-15+ |
| InChIKey | ZOONNXAZPRIFRP-MFKUBSTISA-N |
| XLogP | 6.44 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|