C36H34N4 — CID 102530043
1-N,3-N-bis[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]benzene-1,3-diamine (PubChem CID 102530043) has the molecular formula C36H34N4 and a molecular weight of 522.70 g/mol. Its IUPAC name is 1-N,3-N-bis[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 102530043 |
| Molecular Formula | C36H34N4 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 1-N,3-N-bis[2-[(2,6-dimethylphenyl)iminomethyl]phenyl]benzene-1,3-diamine |
| SMILES | Cc1cccc(C)c1/N=C/c1ccccc1Nc1cccc(Nc2ccccc2/C=N/c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C36H34N4/c1-25-12-9-13-26(2)35(25)37-23-29-16-5-7-20-33(29)39-31-18-11-19-32(22-31)40-34-21-8-6-17-30(34)24-38-36-27(3)14-10-15-28(36)4/h5-24,39-40H,1-4H3/b37-23+,38-24+ |
| InChIKey | YBJAQBRMHPVZEA-DNJOOXRZSA-N |
| XLogP | 9.91 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|