C24H26N2O — CID 139077384
2-[(2,6-diethylphenyl)iminomethyl]-N-(4-methoxyphenyl)aniline (PubChem CID 139077384) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[(2,6-diethylphenyl)iminomethyl]-N-(4-methoxyphenyl)aniline.
| Compound Name | 2-[(2,6-diethylphenyl)iminomethyl]-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 139077384 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-[(2,6-diethylphenyl)iminomethyl]-N-(4-methoxyphenyl)aniline |
| SMILES | CCc1cccc(CC)c1/N=C/c1ccccc1Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H26N2O/c1-4-18-10-8-11-19(5-2)24(18)25-17-20-9-6-7-12-23(20)26-21-13-15-22(27-3)16-14-21/h6-17,26H,4-5H2,1-3H3/b25-17+ |
| InChIKey | AXINDRSCZBWJLV-KOEQRZSOSA-N |
| XLogP | 6.31 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|