C31H32N2O — CID 101467698
2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N-(4-phenoxyphenyl)aniline (PubChem CID 101467698) has the molecular formula C31H32N2O and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N-(4-phenoxyphenyl)aniline.
| Compound Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N-(4-phenoxyphenyl)aniline |
|---|---|
| PubChem CID | 101467698 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-N-(4-phenoxyphenyl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1ccccc1Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O/c1-22(2)28-14-10-15-29(23(3)4)31(28)32-21-24-11-8-9-16-30(24)33-25-17-19-27(20-18-25)34-26-12-6-5-7-13-26/h5-23,33H,1-4H3/b32-21+ |
| InChIKey | BYJGCZRWABTSSX-RUMWWMSVSA-N |
| XLogP | 9.22 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|