C28H29N3 — CID 102529108
2,6-di(propan-2-yl)-N-[2-(quinolin-8-yliminomethyl)phenyl]aniline (PubChem CID 102529108) has the molecular formula C28H29N3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-N-[2-(quinolin-8-yliminomethyl)phenyl]aniline.
| Compound Name | 2,6-di(propan-2-yl)-N-[2-(quinolin-8-yliminomethyl)phenyl]aniline |
|---|---|
| PubChem CID | 102529108 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2,6-di(propan-2-yl)-N-[2-(quinolin-8-yliminomethyl)phenyl]aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1ccccc1/C=N/c1cccc2cccnc12 |
| InChI | InChI=1S/C28H29N3/c1-19(2)23-13-8-14-24(20(3)4)28(23)31-25-15-6-5-10-22(25)18-30-26-16-7-11-21-12-9-17-29-27(21)26/h5-20,31H,1-4H3/b30-18+ |
| InChIKey | VHNWAEPNGZTNSJ-UXHLAJHPSA-N |
| XLogP | 7.98 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|