C19H24N2 — CID 87946949
N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline (PubChem CID 87946949) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline.
| Compound Name | N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 87946949 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline |
| SMILES | [H]/N=C\c1ccccc1Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H24N2/c1-13(2)16-9-7-10-17(14(3)4)19(16)21-18-11-6-5-8-15(18)12-20/h5-14,20-21H,1-4H3/b20-12- |
| InChIKey | PSZKVLODSLITCB-NDENLUEZSA-N |
| XLogP | 5.67 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|