About N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline
N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline (PubChem CID 87946949) has the molecular formula C19H24N2
and a molecular weight of 280.41 g/mol. Its IUPAC name is N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline |
| PubChem CID | 87946949 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline |
| SMILES | [H]/N=C\c1ccccc1Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H24N2/c1-13(2)16-9-7-10-17(14(3)4)19(16)21-18-11-6-5-8-15(18)12-20/h5-14,20-21H,1-4H3/b20-12- |
| InChIKey | PSZKVLODSLITCB-NDENLUEZSA-N |
| XLogP | 5.67 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline?
The IUPAC name of N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline (CID 87946949) is N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline.
What is the SMILES notation for N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline?
The canonical SMILES for N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline is [H]/N=C\c1ccccc1Nc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline?
The InChIKey is PSZKVLODSLITCB-NDENLUEZSA-N. The full InChI is InChI=1S/C19H24N2/c1-13(2)16-9-7-10-17(14(3)4)19(16)21-18-11-6-5-8-15(18)12-20/h5-14,20-21H,1-4H3/b20-12-.
What are the key properties of N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline?
N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline has a molecular weight of 280.41 g/mol, XLogP of 5.67, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methanimidoylphenyl)-2,6-di(propan-2-yl)aniline is sourced from PubChem (CID 87946949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).