C19H26NP — CID 58961695
N-(2-methylphosphanylphenyl)-2,6-di(propan-2-yl)aniline (PubChem CID 58961695) has the molecular formula C19H26NP and a molecular weight of 299.40 g/mol. Its IUPAC name is N-(2-methylphosphanylphenyl)-2,6-di(propan-2-yl)aniline.
| Compound Name | N-(2-methylphosphanylphenyl)-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 58961695 |
| Molecular Formula | C19H26NP |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-(2-methylphosphanylphenyl)-2,6-di(propan-2-yl)aniline |
| SMILES | CPc1ccccc1Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C19H26NP/c1-13(2)15-9-8-10-16(14(3)4)19(15)20-17-11-6-7-12-18(17)21-5/h6-14,20-21H,1-5H3 |
| InChIKey | NLPQRLVPQLQQTA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|