C14H23Cl3CoN — CID 175492359
N-ethyl-2,6-di(propan-2-yl)aniline;trichlorocobalt (PubChem CID 175492359) has the molecular formula C14H23Cl3CoN and a molecular weight of 370.64 g/mol. Its IUPAC name is N-ethyl-2,6-di(propan-2-yl)aniline;trichlorocobalt.
| Compound Name | N-ethyl-2,6-di(propan-2-yl)aniline;trichlorocobalt |
|---|---|
| PubChem CID | 175492359 |
| Molecular Formula | C14H23Cl3CoN |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-ethyl-2,6-di(propan-2-yl)aniline;trichlorocobalt |
| SMILES | CCNc1c(C(C)C)cccc1C(C)C.Cl[Co](Cl)Cl |
| InChI | InChI=1S/C14H23N.3ClH.Co/c1-6-15-14-12(10(2)3)8-7-9-13(14)11(4)5;;;;/h7-11,15H,6H2,1-5H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | AAEVZMYTXCQJCZ-UHFFFAOYSA-K |
| XLogP | 6.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |