C28H44N2O — CID 86189291
N-[2-[2-[2,6-di(propan-2-yl)anilino]ethoxy]ethyl]-2,6-di(propan-2-yl)aniline (PubChem CID 86189291) has the molecular formula C28H44N2O and a molecular weight of 424.67 g/mol. Its IUPAC name is N-[2-[2-[2,6-di(propan-2-yl)anilino]ethoxy]ethyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[2-[2-[2,6-di(propan-2-yl)anilino]ethoxy]ethyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 86189291 |
| Molecular Formula | C28H44N2O |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | N-[2-[2-[2,6-di(propan-2-yl)anilino]ethoxy]ethyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NCCOCCNc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H44N2O/c1-19(2)23-11-9-12-24(20(3)4)27(23)29-15-17-31-18-16-30-28-25(21(5)6)13-10-14-26(28)22(7)8/h9-14,19-22,29-30H,15-18H2,1-8H3 |
| InChIKey | RDVMGCKWMAGLQO-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|