C26H36FeN2+2 — CID 11850391
CID 11850391 (PubChem CID 11850391) has the molecular formula C26H36FeN2+2 and a molecular weight of 432.43 g/mol.
| Compound Name | CID 11850391 |
|---|---|
| PubChem CID | 11850391 |
| Molecular Formula | C26H36FeN2+2 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | — |
| SMILES | CC(NCCNc1c(C(C)C)cccc1C(C)C)[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C21H31N2.C5H5.Fe/c1-15(2)19-11-8-12-20(16(3)4)21(19)23-14-13-22-17(5)18-9-6-7-10-18;1-2-4-5-3-1;/h6-12,15-17,22-23H,13-14H2,1-5H3;1-5H;/q;;+2 |
| InChIKey | QOSMCCDWVNPDHD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|