About N-pent-3-enyl-2,6-di(propan-2-yl)aniline
N-pent-3-enyl-2,6-di(propan-2-yl)aniline (PubChem CID 175052075) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is N-pent-3-enyl-2,6-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-pent-3-enyl-2,6-di(propan-2-yl)aniline |
| PubChem CID | 175052075 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-pent-3-enyl-2,6-di(propan-2-yl)aniline |
| SMILES | CC=CCCNc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C17H27N/c1-6-7-8-12-18-17-15(13(2)3)10-9-11-16(17)14(4)5/h6-7,9-11,13-14,18H,8,12H2,1-5H3 |
| InChIKey | VJBILTSBYKSXDD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-pent-3-enyl-2,6-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pent-3-enyl-2,6-di(propan-2-yl)aniline?
The IUPAC name of N-pent-3-enyl-2,6-di(propan-2-yl)aniline (CID 175052075) is N-pent-3-enyl-2,6-di(propan-2-yl)aniline.
What is the SMILES notation for N-pent-3-enyl-2,6-di(propan-2-yl)aniline?
The canonical SMILES for N-pent-3-enyl-2,6-di(propan-2-yl)aniline is CC=CCCNc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of N-pent-3-enyl-2,6-di(propan-2-yl)aniline?
The InChIKey is VJBILTSBYKSXDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N/c1-6-7-8-12-18-17-15(13(2)3)10-9-11-16(17)14(4)5/h6-7,9-11,13-14,18H,8,12H2,1-5H3.
What are the key properties of N-pent-3-enyl-2,6-di(propan-2-yl)aniline?
N-pent-3-enyl-2,6-di(propan-2-yl)aniline has a molecular weight of 245.41 g/mol, XLogP of 5.31, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pent-3-enyl-2,6-di(propan-2-yl)aniline is sourced from PubChem (CID 175052075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).